C14H8BrN3OS2 — CID 4198753
10-bromo-4-[(3-methylthiophen-2-yl)methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one (PubChem CID 4198753) has the molecular formula C14H8BrN3OS2 and a molecular weight of 378.28 g/mol. Its IUPAC name is 10-bromo-4-[(3-methylthiophen-2-yl)methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one.
| Compound Name | 10-bromo-4-[(3-methylthiophen-2-yl)methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one |
|---|---|
| PubChem CID | 4198753 |
| Molecular Formula | C14H8BrN3OS2 |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 376.93 |
| IUPAC Name | 10-bromo-4-[(3-methylthiophen-2-yl)methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one |
| SMILES | Cc1ccsc1C=c1sc2nc3cc(Br)cnc3n2c1=O |
| InChI | InChI=1S/C14H8BrN3OS2/c1-7-2-3-20-10(7)5-11-13(19)18-12-9(17-14(18)21-11)4-8(15)6-16-12/h2-6H,1H3 |
| InChIKey | GFFLLXJXXSAYAZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |