C15H7BrFN3OS — CID 1001437
(4Z)-10-bromo-4-[(4-fluorophenyl)methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one (PubChem CID 1001437) has the molecular formula C15H7BrFN3OS and a molecular weight of 376.21 g/mol. Its IUPAC name is (4Z)-10-bromo-4-[(4-fluorophenyl)methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one.
| Compound Name | (4Z)-10-bromo-4-[(4-fluorophenyl)methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one |
|---|---|
| PubChem CID | 1001437 |
| Molecular Formula | C15H7BrFN3OS |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | (4Z)-10-bromo-4-[(4-fluorophenyl)methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one |
| SMILES | O=c1/c(=C/c2ccc(F)cc2)sc2nc3cc(Br)cnc3n12 |
| InChI | InChI=1S/C15H7BrFN3OS/c16-9-6-11-13(18-7-9)20-14(21)12(22-15(20)19-11)5-8-1-3-10(17)4-2-8/h1-7H/b12-5- |
| InChIKey | PNGQACYVXTZFQB-XGICHPGQSA-N |
| XLogP | 2.75 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |