C24H24N4O2S — CID 23932460
(1S)-1-(4-benzyl-5-benzylsulfonyl-1,2,4-triazol-3-yl)-2-phenylethanamine (PubChem CID 23932460) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is (1S)-1-(4-benzyl-5-benzylsulfonyl-1,2,4-triazol-3-yl)-2-phenylethanamine.
| Compound Name | (1S)-1-(4-benzyl-5-benzylsulfonyl-1,2,4-triazol-3-yl)-2-phenylethanamine |
|---|---|
| PubChem CID | 23932460 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (1S)-1-(4-benzyl-5-benzylsulfonyl-1,2,4-triazol-3-yl)-2-phenylethanamine |
| SMILES | N[C@@H](Cc1ccccc1)c1nnc(S(=O)(=O)Cc2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H24N4O2S/c25-22(16-19-10-4-1-5-11-19)23-26-27-24(28(23)17-20-12-6-2-7-13-20)31(29,30)18-21-14-8-3-9-15-21/h1-15,22H,16-18,25H2/t22-/m0/s1 |
| InChIKey | WXGRLAWPAFHUPX-QFIPXVFZSA-N |
| XLogP | 3.54 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |