C38H40N6O4S2 — CID 14066234
3-benzylsulfonyl-5-[8-(5-benzylsulfonyl-4-phenyl-1,2,4-triazol-3-yl)octyl]-4-phenyl-1,2,4-triazole (PubChem CID 14066234) has the molecular formula C38H40N6O4S2 and a molecular weight of 708.91 g/mol. Its IUPAC name is 3-benzylsulfonyl-5-[8-(5-benzylsulfonyl-4-phenyl-1,2,4-triazol-3-yl)octyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-benzylsulfonyl-5-[8-(5-benzylsulfonyl-4-phenyl-1,2,4-triazol-3-yl)octyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 14066234 |
| Molecular Formula | C38H40N6O4S2 |
| Molecular Weight | 708.91 g/mol |
| Exact Mass | 708.26 |
| IUPAC Name | 3-benzylsulfonyl-5-[8-(5-benzylsulfonyl-4-phenyl-1,2,4-triazol-3-yl)octyl]-4-phenyl-1,2,4-triazole |
| SMILES | O=S(=O)(Cc1ccccc1)c1nnc(CCCCCCCCc2nnc(S(=O)(=O)Cc3ccccc3)n2-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C38H40N6O4S2/c45-49(46,29-31-19-9-5-10-20-31)37-41-39-35(43(37)33-23-13-7-14-24-33)27-17-3-1-2-4-18-28-36-40-42-38(44(36)34-25-15-8-16-26-34)50(47,48)30-32-21-11-6-12-22-32/h5-16,19-26H,1-4,17-18,27-30H2 |
| InChIKey | PRRDKTBGNOIEKP-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 129.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.91 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|