C17H16ClN5O4S — CID 23854114
2-[4-(4-chlorophenyl)-5-[(3-nitrophenyl)methylsulfonyl]-1,2,4-triazol-3-yl]ethanamine (PubChem CID 23854114) has the molecular formula C17H16ClN5O4S and a molecular weight of 421.87 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-5-[(3-nitrophenyl)methylsulfonyl]-1,2,4-triazol-3-yl]ethanamine.
| Compound Name | 2-[4-(4-chlorophenyl)-5-[(3-nitrophenyl)methylsulfonyl]-1,2,4-triazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 23854114 |
| Molecular Formula | C17H16ClN5O4S |
| Molecular Weight | 421.87 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-5-[(3-nitrophenyl)methylsulfonyl]-1,2,4-triazol-3-yl]ethanamine |
| SMILES | NCCc1nnc(S(=O)(=O)Cc2cccc([N+](=O)[O-])c2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClN5O4S/c18-13-4-6-14(7-5-13)22-16(8-9-19)20-21-17(22)28(26,27)11-12-2-1-3-15(10-12)23(24)25/h1-7,10H,8-9,11,19H2 |
| InChIKey | OCPFYSIXVGDXLW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.87 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|