C23H28N4OS — CID 23933596
(1S)-3-methyl-1-[4-(4-phenylmethoxyphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]butan-1-amine (PubChem CID 23933596) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is (1S)-3-methyl-1-[4-(4-phenylmethoxyphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]butan-1-amine.
| Compound Name | (1S)-3-methyl-1-[4-(4-phenylmethoxyphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 23933596 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (1S)-3-methyl-1-[4-(4-phenylmethoxyphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]butan-1-amine |
| SMILES | C=CCSc1nnc([C@@H](N)CC(C)C)n1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N4OS/c1-4-14-29-23-26-25-22(21(24)15-17(2)3)27(23)19-10-12-20(13-11-19)28-16-18-8-6-5-7-9-18/h4-13,17,21H,1,14-16,24H2,2-3H3/t21-/m0/s1 |
| InChIKey | UEUKSFSLRALYEZ-NRFANRHFSA-N |
| XLogP | 5.17 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|