C16H17F2NO — CID 171313225
(1S)-3,3-difluoro-1-(4-phenylmethoxyphenyl)propan-1-amine (PubChem CID 171313225) has the molecular formula C16H17F2NO and a molecular weight of 277.31 g/mol. Its IUPAC name is (1S)-3,3-difluoro-1-(4-phenylmethoxyphenyl)propan-1-amine.
| Compound Name | (1S)-3,3-difluoro-1-(4-phenylmethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 171313225 |
| Molecular Formula | C16H17F2NO |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (1S)-3,3-difluoro-1-(4-phenylmethoxyphenyl)propan-1-amine |
| SMILES | N[C@@H](CC(F)F)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H17F2NO/c17-16(18)10-15(19)13-6-8-14(9-7-13)20-11-12-4-2-1-3-5-12/h1-9,15-16H,10-11,19H2/t15-/m0/s1 |
| InChIKey | KXIHXFSERGZEQO-HNNXBMFYSA-N |
| XLogP | 3.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |