C22H16ClN3O3S — CID 23935183
[2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 6-chloropyridine-3-carboxylate (PubChem CID 23935183) has the molecular formula C22H16ClN3O3S and a molecular weight of 437.91 g/mol. Its IUPAC name is [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 23935183 |
| Molecular Formula | C22H16ClN3O3S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)COC(=O)c4ccc(Cl)nc4)cc3)sc2c1 |
| InChI | InChI=1S/C22H16ClN3O3S/c1-13-2-8-17-18(10-13)30-21(26-17)14-3-6-16(7-4-14)25-20(27)12-29-22(28)15-5-9-19(23)24-11-15/h2-11H,12H2,1H3,(H,25,27) |
| InChIKey | YEMORUKUOGKULD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|