C12H15N4O2S- — CID 2393534
7-tert-butyl-1,3-dimethyl-2,4-dioxopyrimido[4,5-d]pyrimidine-5-thiolate (PubChem CID 2393534) has the molecular formula C12H15N4O2S- and a molecular weight of 279.35 g/mol. Its IUPAC name is 7-tert-butyl-1,3-dimethyl-2,4-dioxopyrimido[4,5-d]pyrimidine-5-thiolate.
| Compound Name | 7-tert-butyl-1,3-dimethyl-2,4-dioxopyrimido[4,5-d]pyrimidine-5-thiolate |
|---|---|
| PubChem CID | 2393534 |
| Molecular Formula | C12H15N4O2S- |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 7-tert-butyl-1,3-dimethyl-2,4-dioxopyrimido[4,5-d]pyrimidine-5-thiolate |
| SMILES | Cn1c(=O)c2c([S-])nc(C(C)(C)C)nc2n(C)c1=O |
| InChI | InChI=1S/C12H16N4O2S/c1-12(2,3)10-13-7-6(8(19)14-10)9(17)16(5)11(18)15(7)4/h1-5H3,(H,13,14,19)/p-1 |
| InChIKey | NXKJFKZBSPLWDD-UHFFFAOYSA-M |
| XLogP | 0.23 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|