C20H19N3O2 — CID 23935930
N-(4-hydroxyphenyl)-2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)benzamide (PubChem CID 23935930) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)benzamide.
| Compound Name | N-(4-hydroxyphenyl)-2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)benzamide |
|---|---|
| PubChem CID | 23935930 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)benzamide |
| SMILES | O=C(Nc1ccc(O)cc1)c1ccccc1-c1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C20H19N3O2/c24-14-11-9-13(10-12-14)21-20(25)16-6-2-1-5-15(16)19-17-7-3-4-8-18(17)22-23-19/h1-2,5-6,9-12,24H,3-4,7-8H2,(H,21,25)(H,22,23) |
| InChIKey | JJAPXCNJBDHGQL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|