C17H16N2OS2 — CID 23937076
4-(2-phenylethyl)-5-sulfanylidene-2-thia-4,6-diazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-dien-8-one (PubChem CID 23937076) has the molecular formula C17H16N2OS2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-(2-phenylethyl)-5-sulfanylidene-2-thia-4,6-diazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-dien-8-one.
| Compound Name | 4-(2-phenylethyl)-5-sulfanylidene-2-thia-4,6-diazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-dien-8-one |
|---|---|
| PubChem CID | 23937076 |
| Molecular Formula | C17H16N2OS2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 4-(2-phenylethyl)-5-sulfanylidene-2-thia-4,6-diazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-dien-8-one |
| SMILES | O=c1c2c(sc3c1[nH]c(=S)n3CCc1ccccc1)CCC2 |
| InChI | InChI=1S/C17H16N2OS2/c20-15-12-7-4-8-13(12)22-16-14(15)18-17(21)19(16)10-9-11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2,(H,18,21) |
| InChIKey | DONHWQYTSGTODL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|