C28H33N2O2+ — CID 2393745
[2-(benzhydrylamino)-2-oxoethyl]-cyclohexyl-[(2-hydroxyphenyl)methyl]azanium (PubChem CID 2393745) has the molecular formula C28H33N2O2+ and a molecular weight of 429.58 g/mol. Its IUPAC name is [2-(benzhydrylamino)-2-oxoethyl]-cyclohexyl-[(2-hydroxyphenyl)methyl]azanium.
| Compound Name | [2-(benzhydrylamino)-2-oxoethyl]-cyclohexyl-[(2-hydroxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 2393745 |
| Molecular Formula | C28H33N2O2+ |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | [2-(benzhydrylamino)-2-oxoethyl]-cyclohexyl-[(2-hydroxyphenyl)methyl]azanium |
| SMILES | O=C(C[NH+](Cc1ccccc1O)C1CCCCC1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N2O2/c31-26-19-11-10-16-24(26)20-30(25-17-8-3-9-18-25)21-27(32)29-28(22-12-4-1-5-13-22)23-14-6-2-7-15-23/h1-2,4-7,10-16,19,25,28,31H,3,8-9,17-18,20-21H2,(H,29,32)/p+1 |
| InChIKey | LCFOPTLAHZLLIQ-UHFFFAOYSA-O |
| XLogP | 4.02 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|