C27H30N4O3 — CID 23937573
4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-N-(2-ethylphenyl)-3-nitrobenzamide (PubChem CID 23937573) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-N-(2-ethylphenyl)-3-nitrobenzamide.
| Compound Name | 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-N-(2-ethylphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 23937573 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-N-(2-ethylphenyl)-3-nitrobenzamide |
| SMILES | CCc1ccccc1NC(=O)c1ccc(N2CCN(c3cc(C)ccc3C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H30N4O3/c1-4-21-7-5-6-8-23(21)28-27(32)22-11-12-24(26(18-22)31(33)34)29-13-15-30(16-14-29)25-17-19(2)9-10-20(25)3/h5-12,17-18H,4,13-16H2,1-3H3,(H,28,32) |
| InChIKey | LHOAGJCGJSKQMW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|