C18H22N4O2S — CID 23940334
3-methyl-7-(3-methylbutyl)-8-(phenylsulfanylmethyl)purine-2,6-dione (PubChem CID 23940334) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 3-methyl-7-(3-methylbutyl)-8-(phenylsulfanylmethyl)purine-2,6-dione.
| Compound Name | 3-methyl-7-(3-methylbutyl)-8-(phenylsulfanylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 23940334 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 3-methyl-7-(3-methylbutyl)-8-(phenylsulfanylmethyl)purine-2,6-dione |
| SMILES | CC(C)CCn1c(CSc2ccccc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C18H22N4O2S/c1-12(2)9-10-22-14(11-25-13-7-5-4-6-8-13)19-16-15(22)17(23)20-18(24)21(16)3/h4-8,12H,9-11H2,1-3H3,(H,20,23,24) |
| InChIKey | HMEOSUNJPBASQR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |