C28H27BrN2O5S — CID 23940899
methyl 1-(4-bromophenyl)sulfonyl-2,4-diphenyl-5-(prop-2-enylcarbamoyl)pyrrolidine-3-carboxylate (PubChem CID 23940899) has the molecular formula C28H27BrN2O5S and a molecular weight of 583.50 g/mol. Its IUPAC name is methyl 1-(4-bromophenyl)sulfonyl-2,4-diphenyl-5-(prop-2-enylcarbamoyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(4-bromophenyl)sulfonyl-2,4-diphenyl-5-(prop-2-enylcarbamoyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 23940899 |
| Molecular Formula | C28H27BrN2O5S |
| Molecular Weight | 583.50 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | methyl 1-(4-bromophenyl)sulfonyl-2,4-diphenyl-5-(prop-2-enylcarbamoyl)pyrrolidine-3-carboxylate |
| SMILES | C=CCNC(=O)C1C(c2ccccc2)C(C(=O)OC)C(c2ccccc2)N1S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C28H27BrN2O5S/c1-3-18-30-27(32)26-23(19-10-6-4-7-11-19)24(28(33)36-2)25(20-12-8-5-9-13-20)31(26)37(34,35)22-16-14-21(29)15-17-22/h3-17,23-26H,1,18H2,2H3,(H,30,32) |
| InChIKey | XKKVGABVSOHOOV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|