C38H40FN3O5Si — CID 23956454
N-benzyl-2-[(2'S,3S,3'R,4'S)-3'-[fluoro(dimethyl)silyl]-5-(N-formylanilino)-4'-methyl-2-oxo-1-phenylspiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 23956454) has the molecular formula C38H40FN3O5Si and a molecular weight of 665.84 g/mol. Its IUPAC name is N-benzyl-2-[(2'S,3S,3'R,4'S)-3'-[fluoro(dimethyl)silyl]-5-(N-formylanilino)-4'-methyl-2-oxo-1-phenylspiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(2'S,3S,3'R,4'S)-3'-[fluoro(dimethyl)silyl]-5-(N-formylanilino)-4'-methyl-2-oxo-1-phenylspiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 23956454 |
| Molecular Formula | C38H40FN3O5Si |
| Molecular Weight | 665.84 g/mol |
| Exact Mass | 665.27 |
| IUPAC Name | N-benzyl-2-[(2'S,3S,3'R,4'S)-3'-[fluoro(dimethyl)silyl]-5-(N-formylanilino)-4'-methyl-2-oxo-1-phenylspiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CC(=O)N(CCO)Cc2ccccc2)O[C@@]12C(=O)N(c1ccccc1)c1ccc(N(C=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C38H40FN3O5Si/c1-27-36(48(2,3)39)34(24-35(45)40(21-22-43)25-28-13-7-4-8-14-28)47-38(27)32-23-31(41(26-44)29-15-9-5-10-16-29)19-20-33(32)42(37(38)46)30-17-11-6-12-18-30/h4-20,23,26-27,34,36,43H,21-22,24-25H2,1-3H3/t27-,34+,36-,38+/m1/s1 |
| InChIKey | XUPHMAQRTDSVPT-LPKBYQFISA-N |
| XLogP | 6.85 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.84 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|