C33H46N6O5Si — CID 23957587
3-[(2S,3S,4S)-2-[1-[hydroxy(dimethyl)silyl]-3-[4-(2-hydroxyethyl)triazol-1-yl]propyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 23957587) has the molecular formula C33H46N6O5Si and a molecular weight of 634.85 g/mol. Its IUPAC name is 3-[(2S,3S,4S)-2-[1-[hydroxy(dimethyl)silyl]-3-[4-(2-hydroxyethyl)triazol-1-yl]propyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 3-[(2S,3S,4S)-2-[1-[hydroxy(dimethyl)silyl]-3-[4-(2-hydroxyethyl)triazol-1-yl]propyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 23957587 |
| Molecular Formula | C33H46N6O5Si |
| Molecular Weight | 634.85 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | 3-[(2S,3S,4S)-2-[1-[hydroxy(dimethyl)silyl]-3-[4-(2-hydroxyethyl)triazol-1-yl]propyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CO[C@@H]1c2cc(N3CN(c4ccccc4)C4(CCNCC4)C3=O)ccc2O[C@H](C(CCn2cc(CCO)nn2)[Si](C)(C)O)[C@H]1C |
| InChI | InChI=1S/C33H46N6O5Si/c1-23-30(43-2)27-20-26(38-22-39(25-8-6-5-7-9-25)33(32(38)41)14-16-34-17-15-33)10-11-28(27)44-31(23)29(45(3,4)42)12-18-37-21-24(13-19-40)35-36-37/h5-11,20-21,23,29-31,34,40,42H,12-19,22H2,1-4H3/t23-,29?,30-,31-/m0/s1 |
| InChIKey | FZMSYQOOHBDVTH-KSYJAZCQSA-N |
| XLogP | 3.49 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.85 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|