C17H13F2N3O2 — CID 23963431
6,7-difluoro-N-(2-methoxyphenyl)-3-methylquinoxaline-2-carboxamide (PubChem CID 23963431) has the molecular formula C17H13F2N3O2 and a molecular weight of 329.31 g/mol. Its IUPAC name is 6,7-difluoro-N-(2-methoxyphenyl)-3-methylquinoxaline-2-carboxamide.
| Compound Name | 6,7-difluoro-N-(2-methoxyphenyl)-3-methylquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 23963431 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 6,7-difluoro-N-(2-methoxyphenyl)-3-methylquinoxaline-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1nc2cc(F)c(F)cc2nc1C |
| InChI | InChI=1S/C17H13F2N3O2/c1-9-16(17(23)22-12-5-3-4-6-15(12)24-2)21-14-8-11(19)10(18)7-13(14)20-9/h3-8H,1-2H3,(H,22,23) |
| InChIKey | GEMLLJNGVLBMDW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |