C14H14N6O2 — CID 66499445
N-(2-methoxyphenyl)-4,7-dimethyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine-3-carboxamide (PubChem CID 66499445) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4,7-dimethyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine-3-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-4,7-dimethyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine-3-carboxamide |
|---|---|
| PubChem CID | 66499445 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N-(2-methoxyphenyl)-4,7-dimethyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine-3-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1nnc2nc(C)nn2c1C |
| InChI | InChI=1S/C14H14N6O2/c1-8-12(17-18-14-15-9(2)19-20(8)14)13(21)16-10-6-4-5-7-11(10)22-3/h4-7H,1-3H3,(H,16,21) |
| InChIKey | LOKFMTADGJAOGR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |