About N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline
N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline (PubChem CID 23965934) has the molecular formula C22H21BrN4
and a molecular weight of 421.34 g/mol. Its IUPAC name is N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline.
Molecular Properties
| Compound Name | N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline |
| PubChem CID | 23965934 |
| Molecular Formula | C22H21BrN4 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline |
| SMILES | Cc1cc(C)n2c(Br)c(CN(Cc3ccccc3)c3ccccc3)nc2n1 |
| InChI | InChI=1S/C22H21BrN4/c1-16-13-17(2)27-21(23)20(25-22(27)24-16)15-26(19-11-7-4-8-12-19)14-18-9-5-3-6-10-18/h3-13H,14-15H2,1-2H3 |
| InChIKey | ABJYUVUDFGKOEO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline?
The IUPAC name of N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline (CID 23965934) is N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline.
What is the SMILES notation for N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline?
The canonical SMILES for N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline is Cc1cc(C)n2c(Br)c(CN(Cc3ccccc3)c3ccccc3)nc2n1.
What is the InChIKey of N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline?
The InChIKey is ABJYUVUDFGKOEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21BrN4/c1-16-13-17(2)27-21(23)20(25-22(27)24-16)15-26(19-11-7-4-8-12-19)14-18-9-5-3-6-10-18/h3-13H,14-15H2,1-2H3.
What are the key properties of N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline?
N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline has a molecular weight of 421.34 g/mol, XLogP of 5.32, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]aniline is sourced from PubChem (CID 23965934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).