About 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine
4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine (PubChem CID 23766177) has the molecular formula C13H17BrN4O
and a molecular weight of 325.21 g/mol. Its IUPAC name is 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine.
Molecular Properties
| Compound Name | 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine |
| PubChem CID | 23766177 |
| Molecular Formula | C13H17BrN4O |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine |
| SMILES | Cc1cc(C)n2c(Br)c(CN3CCOCC3)nc2n1 |
| InChI | InChI=1S/C13H17BrN4O/c1-9-7-10(2)18-12(14)11(16-13(18)15-9)8-17-3-5-19-6-4-17/h7H,3-6,8H2,1-2H3 |
| InChIKey | RYSGBTCADGVSQX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine?
The IUPAC name of 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine (CID 23766177) is 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine.
What is the SMILES notation for 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine?
The canonical SMILES for 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine is Cc1cc(C)n2c(Br)c(CN3CCOCC3)nc2n1.
What is the InChIKey of 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine?
The InChIKey is RYSGBTCADGVSQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrN4O/c1-9-7-10(2)18-12(14)11(16-13(18)15-9)8-17-3-5-19-6-4-17/h7H,3-6,8H2,1-2H3.
What are the key properties of 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine?
4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine has a molecular weight of 325.21 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]morpholine is sourced from PubChem (CID 23766177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).