About [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine
[6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine (PubChem CID 80655372) has the molecular formula C11H19N5O
and a molecular weight of 237.31 g/mol. Its IUPAC name is [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine |
| PubChem CID | 80655372 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1cc(NN)nc(CN2CCCOCC2)n1 |
| InChI | InChI=1S/C11H19N5O/c1-9-7-10(15-12)14-11(13-9)8-16-3-2-5-17-6-4-16/h7H,2-6,8,12H2,1H3,(H,13,14,15) |
| InChIKey | LVJPNXAVXVNDIB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine?
The IUPAC name of [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine (CID 80655372) is [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine?
The canonical SMILES for [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine is Cc1cc(NN)nc(CN2CCCOCC2)n1.
What is the InChIKey of [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine?
The InChIKey is LVJPNXAVXVNDIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O/c1-9-7-10(15-12)14-11(13-9)8-16-3-2-5-17-6-4-16/h7H,2-6,8,12H2,1H3,(H,13,14,15).
What are the key properties of [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine?
[6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine has a molecular weight of 237.31 g/mol, XLogP of 0.29, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methyl-2-(1,4-oxazepan-4-ylmethyl)pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 80655372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).