C13H13N3O2S — CID 23967006
6,6-dimethyl-5-oxa-16-thia-9,12,14-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),2,8,11(15)-tetraen-13-one (PubChem CID 23967006) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 6,6-dimethyl-5-oxa-16-thia-9,12,14-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),2,8,11(15)-tetraen-13-one.
| Compound Name | 6,6-dimethyl-5-oxa-16-thia-9,12,14-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),2,8,11(15)-tetraen-13-one |
|---|---|
| PubChem CID | 23967006 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 6,6-dimethyl-5-oxa-16-thia-9,12,14-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),2,8,11(15)-tetraen-13-one |
| SMILES | CC1(C)Cc2nc3c(cc2CO1)sc1[nH]c(=O)[nH]c13 |
| InChI | InChI=1S/C13H13N3O2S/c1-13(2)4-7-6(5-18-13)3-8-9(14-7)10-11(19-8)16-12(17)15-10/h3H,4-5H2,1-2H3,(H2,15,16,17) |
| InChIKey | HCYQAKPDRONEGS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |