C24H23ClN2O3S — CID 23967736
2-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 23967736) has the molecular formula C24H23ClN2O3S and a molecular weight of 454.98 g/mol. Its IUPAC name is 2-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23967736 |
| Molecular Formula | C24H23ClN2O3S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1cc(C2NC(=O)c3c(sc4c3CCCC4)N2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H23ClN2O3S/c1-29-19-12-14(10-11-18(19)30-13-15-6-2-4-8-17(15)25)22-26-23(28)21-16-7-3-5-9-20(16)31-24(21)27-22/h2,4,6,8,10-12,22,27H,3,5,7,9,13H2,1H3,(H,26,28) |
| InChIKey | GHTONXJYBFXLML-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |