C21H21N3O4S — CID 23968051
2-[3-[2-(1,3-benzodioxol-5-yl)ethyl]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-phenylacetamide (PubChem CID 23968051) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-[3-[2-(1,3-benzodioxol-5-yl)ethyl]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-phenylacetamide.
| Compound Name | 2-[3-[2-(1,3-benzodioxol-5-yl)ethyl]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 23968051 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-[3-[2-(1,3-benzodioxol-5-yl)ethyl]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-phenylacetamide |
| SMILES | CN1C(=O)C(CC(=O)Nc2ccccc2)N(CCc2ccc3c(c2)OCO3)C1=S |
| InChI | InChI=1S/C21H21N3O4S/c1-23-20(26)16(12-19(25)22-15-5-3-2-4-6-15)24(21(23)29)10-9-14-7-8-17-18(11-14)28-13-27-17/h2-8,11,16H,9-10,12-13H2,1H3,(H,22,25) |
| InChIKey | MMBWFYNGNLYKOZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|