C18H19NOS — CID 23969323
2-ethyl-3-(4-methoxyphenyl)-3,4-dihydroisoquinoline-1-thione (PubChem CID 23969323) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-ethyl-3-(4-methoxyphenyl)-3,4-dihydroisoquinoline-1-thione.
| Compound Name | 2-ethyl-3-(4-methoxyphenyl)-3,4-dihydroisoquinoline-1-thione |
|---|---|
| PubChem CID | 23969323 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-ethyl-3-(4-methoxyphenyl)-3,4-dihydroisoquinoline-1-thione |
| SMILES | CCN1C(=S)c2ccccc2CC1c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H19NOS/c1-3-19-17(13-8-10-15(20-2)11-9-13)12-14-6-4-5-7-16(14)18(19)21/h4-11,17H,3,12H2,1-2H3 |
| InChIKey | RVXBAJXTEPROQP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|