C22H23N3O3S3 — CID 23970482
methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 23970482) has the molecular formula C22H23N3O3S3 and a molecular weight of 473.65 g/mol. Its IUPAC name is methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23970482 |
| Molecular Formula | C22H23N3O3S3 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(C)Sc2nnc(C)s2)sc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C22H23N3O3S3/c1-12(29-22-25-24-13(2)30-22)19(26)23-20-18(21(27)28-3)16-10-9-15(11-17(16)31-20)14-7-5-4-6-8-14/h4-8,12,15H,9-11H2,1-3H3,(H,23,26) |
| InChIKey | ZKWYOSRDBPWCRW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |