C14H14N7O+ — CID 2397121
2-amino-4-(cyanomethyl)-6-(4-formylpiperazin-1-yl)pyridin-1-ium-3,5-dicarbonitrile (PubChem CID 2397121) has the molecular formula C14H14N7O+ and a molecular weight of 296.31 g/mol. Its IUPAC name is 2-amino-4-(cyanomethyl)-6-(4-formylpiperazin-1-yl)pyridin-1-ium-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(cyanomethyl)-6-(4-formylpiperazin-1-yl)pyridin-1-ium-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 2397121 |
| Molecular Formula | C14H14N7O+ |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-amino-4-(cyanomethyl)-6-(4-formylpiperazin-1-yl)pyridin-1-ium-3,5-dicarbonitrile |
| SMILES | N#CCc1c(C#N)c(N)[nH+]c(N2CCN(C=O)CC2)c1C#N |
| InChI | InChI=1S/C14H13N7O/c15-2-1-10-11(7-16)13(18)19-14(12(10)8-17)21-5-3-20(9-22)4-6-21/h9H,1,3-6H2,(H2,18,19)/p+1 |
| InChIKey | JLICFWOVWLMQBJ-UHFFFAOYSA-O |
| XLogP | -0.83 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|