C10H9Cl3N3O+ — CID 6938265
2,4,5-trichloro-6-morpholin-4-ylpyridin-1-ium-3-carbonitrile (PubChem CID 6938265) has the molecular formula C10H9Cl3N3O+ and a molecular weight of 293.56 g/mol. Its IUPAC name is 2,4,5-trichloro-6-morpholin-4-ylpyridin-1-ium-3-carbonitrile.
| Compound Name | 2,4,5-trichloro-6-morpholin-4-ylpyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 6938265 |
| Molecular Formula | C10H9Cl3N3O+ |
| Molecular Weight | 293.56 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 2,4,5-trichloro-6-morpholin-4-ylpyridin-1-ium-3-carbonitrile |
| SMILES | N#Cc1c(Cl)[nH+]c(N2CCOCC2)c(Cl)c1Cl |
| InChI | InChI=1S/C10H8Cl3N3O/c11-7-6(5-14)9(13)15-10(8(7)12)16-1-3-17-4-2-16/h1-4H2/p+1 |
| InChIKey | KEGKAFCYFIKHHZ-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 50.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|