C32H24N4O4S2 — CID 23972990
3,4-diamino-2-N,5-N-bis(4-phenoxyphenyl)thieno[2,3-b]thiophene-2,5-dicarboxamide (PubChem CID 23972990) has the molecular formula C32H24N4O4S2 and a molecular weight of 592.70 g/mol. Its IUPAC name is 3,4-diamino-2-N,5-N-bis(4-phenoxyphenyl)thieno[2,3-b]thiophene-2,5-dicarboxamide.
| Compound Name | 3,4-diamino-2-N,5-N-bis(4-phenoxyphenyl)thieno[2,3-b]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 23972990 |
| Molecular Formula | C32H24N4O4S2 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | 3,4-diamino-2-N,5-N-bis(4-phenoxyphenyl)thieno[2,3-b]thiophene-2,5-dicarboxamide |
| SMILES | Nc1c(C(=O)Nc2ccc(Oc3ccccc3)cc2)sc2sc(C(=O)Nc3ccc(Oc4ccccc4)cc3)c(N)c12 |
| InChI | InChI=1S/C32H24N4O4S2/c33-26-25-27(34)29(31(38)36-20-13-17-24(18-14-20)40-22-9-5-2-6-10-22)42-32(25)41-28(26)30(37)35-19-11-15-23(16-12-19)39-21-7-3-1-4-8-21/h1-18H,33-34H2,(H,35,37)(H,36,38) |
| InChIKey | AHKJRASXILSFSM-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |