C35H29F6NO4 — CID 23974586
(3R,5aR,8aS,8bR)-7-[3,5-bis(trifluoromethyl)phenyl]-3-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23974586) has the molecular formula C35H29F6NO4 and a molecular weight of 641.61 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-[3,5-bis(trifluoromethyl)phenyl]-3-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-[3,5-bis(trifluoromethyl)phenyl]-3-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23974586 |
| Molecular Formula | C35H29F6NO4 |
| Molecular Weight | 641.61 g/mol |
| Exact Mass | 641.20 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-[3,5-bis(trifluoromethyl)phenyl]-3-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CC1=C2[C@@H](CC/C(=C/c3cccc(O)c3)c3ccccc3)OC[C@@H]2[C@@H]2C(=O)N(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C35H29F6NO4/c1-19-12-27-31(33(45)42(32(27)44)25-16-23(34(36,37)38)15-24(17-25)35(39,40)41)28-18-46-29(30(19)28)11-10-22(21-7-3-2-4-8-21)13-20-6-5-9-26(43)14-20/h2-9,13-17,27-29,31,43H,10-12,18H2,1H3/b22-13-/t27-,28+,29-,31-/m1/s1 |
| InChIKey | VALQPHSGXBPHIJ-UCDONBFDSA-N |
| XLogP | 8.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.61 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|