C32H43N5O5S — CID 23979727
pent-4-enyl (5S,6S,7R)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23979727) has the molecular formula C32H43N5O5S and a molecular weight of 609.79 g/mol. Its IUPAC name is pent-4-enyl (5S,6S,7R)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5S,6S,7R)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23979727 |
| Molecular Formula | C32H43N5O5S |
| Molecular Weight | 609.79 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | pent-4-enyl (5S,6S,7R)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)N(CC=C)Cn3nnc4ccccc43)C23S[C@@H]1CC3C |
| InChI | InChI=1S/C32H43N5O5S/c1-6-9-12-16-42-31(41)26-25-17-21(5)32(43-25)27(26)29(39)37(24(18-38)20(4)8-3)28(32)30(40)35(15-7-2)19-36-23-14-11-10-13-22(23)33-34-36/h6-7,10-11,13-14,20-21,24-28,38H,1-2,8-9,12,15-19H2,3-5H3/t20-,21?,24-,25+,26-,27-,28?,32?/m0/s1 |
| InChIKey | OWCHUDUZSSLAFX-PCIKWVIRSA-N |
| XLogP | 3.66 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.79 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|