C29H38FN5O4 — CID 23986130
(3S,3'R,4'R,5'S)-4'-(2-fluoropropan-2-yl)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23986130) has the molecular formula C29H38FN5O4 and a molecular weight of 539.65 g/mol. Its IUPAC name is (3S,3'R,4'R,5'S)-4'-(2-fluoropropan-2-yl)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'R,4'R,5'S)-4'-(2-fluoropropan-2-yl)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23986130 |
| Molecular Formula | C29H38FN5O4 |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | (3S,3'R,4'R,5'S)-4'-(2-fluoropropan-2-yl)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | C=CCN1C(=O)[C@@]2(O[C@@H](CCn3cc(CCO)nn3)[C@H](C(C)(C)F)[C@H]2C)c2cc(N3CCCCC3=O)ccc21 |
| InChI | InChI=1S/C29H38FN5O4/c1-5-13-35-23-10-9-21(34-14-7-6-8-25(34)37)17-22(23)29(27(35)38)19(2)26(28(3,4)30)24(39-29)11-15-33-18-20(12-16-36)31-32-33/h5,9-10,17-19,24,26,36H,1,6-8,11-16H2,2-4H3/t19-,24+,26-,29+/m1/s1 |
| InChIKey | SQECDDGYICEPPY-LUHRNEFFSA-N |
| XLogP | 3.55 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|