C28H32N2O4S — CID 23986717
1-[(4-ethylphenoxy)methyl]-6,7-dimethoxy-N-(4-methoxyphenyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 23986717) has the molecular formula C28H32N2O4S and a molecular weight of 492.64 g/mol. Its IUPAC name is 1-[(4-ethylphenoxy)methyl]-6,7-dimethoxy-N-(4-methoxyphenyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | 1-[(4-ethylphenoxy)methyl]-6,7-dimethoxy-N-(4-methoxyphenyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 23986717 |
| Molecular Formula | C28H32N2O4S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 1-[(4-ethylphenoxy)methyl]-6,7-dimethoxy-N-(4-methoxyphenyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | CCc1ccc(OCC2c3cc(OC)c(OC)cc3CCN2C(=S)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H32N2O4S/c1-5-19-6-10-23(11-7-19)34-18-25-24-17-27(33-4)26(32-3)16-20(24)14-15-30(25)28(35)29-21-8-12-22(31-2)13-9-21/h6-13,16-17,25H,5,14-15,18H2,1-4H3,(H,29,35) |
| InChIKey | DKNRZORCUVFIEA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|