C22H20N2OS — CID 23987823
2-[(2-methyl-1H-indol-3-yl)methylsulfanyl]-N-naphthalen-1-ylacetamide (PubChem CID 23987823) has the molecular formula C22H20N2OS and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-[(2-methyl-1H-indol-3-yl)methylsulfanyl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(2-methyl-1H-indol-3-yl)methylsulfanyl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 23987823 |
| Molecular Formula | C22H20N2OS |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[(2-methyl-1H-indol-3-yl)methylsulfanyl]-N-naphthalen-1-ylacetamide |
| SMILES | Cc1[nH]c2ccccc2c1CSCC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H20N2OS/c1-15-19(18-10-4-5-11-21(18)23-15)13-26-14-22(25)24-20-12-6-8-16-7-2-3-9-17(16)20/h2-12,23H,13-14H2,1H3,(H,24,25) |
| InChIKey | HKJNCPJILFNVOJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|