C24H22N4O4 — CID 23988003
N-(2-cyclohexyl-4-oxoquinazolin-3-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 23988003) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is N-(2-cyclohexyl-4-oxoquinazolin-3-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(2-cyclohexyl-4-oxoquinazolin-3-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 23988003 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-(2-cyclohexyl-4-oxoquinazolin-3-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nn1c(C2CCCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H22N4O4/c29-20(14-27-22(30)16-10-4-5-11-17(16)23(27)31)26-28-21(15-8-2-1-3-9-15)25-19-13-7-6-12-18(19)24(28)32/h4-7,10-13,15H,1-3,8-9,14H2,(H,26,29) |
| InChIKey | CPPYYMRKBTZELI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|