C18H19N5O5S — CID 23993203
propan-2-yl 4-amino-5-(4-hydroxy-3-nitrophenyl)-7-methyl-2-sulfanylidene-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 23993203) has the molecular formula C18H19N5O5S and a molecular weight of 417.45 g/mol. Its IUPAC name is propan-2-yl 4-amino-5-(4-hydroxy-3-nitrophenyl)-7-methyl-2-sulfanylidene-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl 4-amino-5-(4-hydroxy-3-nitrophenyl)-7-methyl-2-sulfanylidene-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23993203 |
| Molecular Formula | C18H19N5O5S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | propan-2-yl 4-amino-5-(4-hydroxy-3-nitrophenyl)-7-methyl-2-sulfanylidene-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2ccc(O)c([N+](=O)[O-])c2)c2c(nc(=S)[nH]c2N)N1 |
| InChI | InChI=1S/C18H19N5O5S/c1-7(2)28-17(25)12-8(3)20-16-14(15(19)21-18(29)22-16)13(12)9-4-5-11(24)10(6-9)23(26)27/h4-7,13,24H,1-3H3,(H4,19,20,21,22,29) |
| InChIKey | DWRYEHMWCKVKFW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 156.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|