C17H17N5O6 — CID 23739571
ethyl 4-amino-5-(4-hydroxy-3-nitrophenyl)-7-methyl-2-oxo-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 23739571) has the molecular formula C17H17N5O6 and a molecular weight of 387.35 g/mol. Its IUPAC name is ethyl 4-amino-5-(4-hydroxy-3-nitrophenyl)-7-methyl-2-oxo-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 4-amino-5-(4-hydroxy-3-nitrophenyl)-7-methyl-2-oxo-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23739571 |
| Molecular Formula | C17H17N5O6 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | ethyl 4-amino-5-(4-hydroxy-3-nitrophenyl)-7-methyl-2-oxo-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(=O)[nH]c(N)c2C1c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N5O6/c1-3-28-16(24)11-7(2)19-15-13(14(18)20-17(25)21-15)12(11)8-4-5-10(23)9(6-8)22(26)27/h4-6,12,23H,3H2,1-2H3,(H4,18,19,20,21,25) |
| InChIKey | PPJQDMGQXJQCMR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 173.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|