C29H20Cl2N4O4S — CID 23996065
2-[3-(3-chloro-4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-chloro-3-nitrophenyl)-2-phenylacetamide (PubChem CID 23996065) has the molecular formula C29H20Cl2N4O4S and a molecular weight of 591.48 g/mol. Its IUPAC name is 2-[3-(3-chloro-4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-chloro-3-nitrophenyl)-2-phenylacetamide.
| Compound Name | 2-[3-(3-chloro-4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-chloro-3-nitrophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 23996065 |
| Molecular Formula | C29H20Cl2N4O4S |
| Molecular Weight | 591.48 g/mol |
| Exact Mass | 590.06 |
| IUPAC Name | 2-[3-(3-chloro-4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-chloro-3-nitrophenyl)-2-phenylacetamide |
| SMILES | Cc1ccc(-n2c(SC(C(=O)Nc3ccc(Cl)c([N+](=O)[O-])c3)c3ccccc3)nc3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C29H20Cl2N4O4S/c1-17-11-13-20(16-23(17)31)34-28(37)21-9-5-6-10-24(21)33-29(34)40-26(18-7-3-2-4-8-18)27(36)32-19-12-14-22(30)25(15-19)35(38)39/h2-16,26H,1H3,(H,32,36) |
| InChIKey | SEUROALCWKAHQM-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.48 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|