C16H13Cl2NO6 — CID 23996367
[1-(3,5-dichloroanilino)-1-oxopropan-2-yl] 3,4,5-trihydroxybenzoate (PubChem CID 23996367) has the molecular formula C16H13Cl2NO6 and a molecular weight of 386.19 g/mol. Its IUPAC name is [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 23996367 |
| Molecular Formula | C16H13Cl2NO6 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] 3,4,5-trihydroxybenzoate |
| SMILES | CC(OC(=O)c1cc(O)c(O)c(O)c1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2NO6/c1-7(15(23)19-11-5-9(17)4-10(18)6-11)25-16(24)8-2-12(20)14(22)13(21)3-8/h2-7,20-22H,1H3,(H,19,23) |
| InChIKey | VQCNYNMVPWVHNB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|