C14H15Cl2NO3 — CID 4233466
[1-(3,5-dichloroanilino)-1-oxopropan-2-yl] 3-methylbut-2-enoate (PubChem CID 4233466) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] 3-methylbut-2-enoate.
| Compound Name | [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 4233466 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OC(C)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H15Cl2NO3/c1-8(2)4-13(18)20-9(3)14(19)17-12-6-10(15)5-11(16)7-12/h4-7,9H,1-3H3,(H,17,19) |
| InChIKey | BWNQSWULWJPCPO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|