C30H27ClN2O4 — CID 23998981
2-chloro-5-[4-[4-(dimethylamino)phenyl]-2,5-dioxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinolin-1-yl]benzoic acid (PubChem CID 23998981) has the molecular formula C30H27ClN2O4 and a molecular weight of 515.01 g/mol. Its IUPAC name is 2-chloro-5-[4-[4-(dimethylamino)phenyl]-2,5-dioxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinolin-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[4-[4-(dimethylamino)phenyl]-2,5-dioxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinolin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 23998981 |
| Molecular Formula | C30H27ClN2O4 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 2-chloro-5-[4-[4-(dimethylamino)phenyl]-2,5-dioxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinolin-1-yl]benzoic acid |
| SMILES | CN(C)c1ccc(C2CC(=O)N(c3ccc(Cl)c(C(=O)O)c3)C3=C2C(=O)CC(c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C30H27ClN2O4/c1-32(2)21-10-8-19(9-11-21)23-17-28(35)33(22-12-13-25(31)24(16-22)30(36)37)26-14-20(15-27(34)29(23)26)18-6-4-3-5-7-18/h3-13,16,20,23H,14-15,17H2,1-2H3,(H,36,37) |
| InChIKey | KZAOPEGSBOWAFJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|