C27H28ClNO7 — CID 23943273
2-chloro-5-[7,7-dimethyl-2,5-dioxo-4-(3,4,5-trimethoxyphenyl)-3,4,6,8-tetrahydroquinolin-1-yl]benzoic acid (PubChem CID 23943273) has the molecular formula C27H28ClNO7 and a molecular weight of 513.97 g/mol. Its IUPAC name is 2-chloro-5-[7,7-dimethyl-2,5-dioxo-4-(3,4,5-trimethoxyphenyl)-3,4,6,8-tetrahydroquinolin-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[7,7-dimethyl-2,5-dioxo-4-(3,4,5-trimethoxyphenyl)-3,4,6,8-tetrahydroquinolin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 23943273 |
| Molecular Formula | C27H28ClNO7 |
| Molecular Weight | 513.97 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 2-chloro-5-[7,7-dimethyl-2,5-dioxo-4-(3,4,5-trimethoxyphenyl)-3,4,6,8-tetrahydroquinolin-1-yl]benzoic acid |
| SMILES | COc1cc(C2CC(=O)N(c3ccc(Cl)c(C(=O)O)c3)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1OC |
| InChI | InChI=1S/C27H28ClNO7/c1-27(2)12-19-24(20(30)13-27)16(14-8-21(34-3)25(36-5)22(9-14)35-4)11-23(31)29(19)15-6-7-18(28)17(10-15)26(32)33/h6-10,16H,11-13H2,1-5H3,(H,32,33) |
| InChIKey | WXJGZDPCJLHNPG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.97 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |