C25H27NO5 — CID 7426529
(4S)-1-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione (PubChem CID 7426529) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is (4S)-1-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione.
| Compound Name | (4S)-1-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 7426529 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (4S)-1-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
| SMILES | COc1cc([C@@H]2CC(=O)N(c3ccc(C)cc3)C3=C2C(=O)CCC3)cc(OC)c1OC |
| InChI | InChI=1S/C25H27NO5/c1-15-8-10-17(11-9-15)26-19-6-5-7-20(27)24(19)18(14-23(26)28)16-12-21(29-2)25(31-4)22(13-16)30-3/h8-13,18H,5-7,14H2,1-4H3/t18-/m0/s1 |
| InChIKey | VJMAXHWYXBJFFG-SFHVURJKSA-N |
| XLogP | 4.55 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |