C23H24N2O6S — CID 25039684
4-[4-(2,4-dimethoxyphenyl)-2,5-dioxo-4,6,7,8-tetrahydro-3H-quinolin-1-yl]benzenesulfonamide (PubChem CID 25039684) has the molecular formula C23H24N2O6S and a molecular weight of 456.52 g/mol. Its IUPAC name is 4-[4-(2,4-dimethoxyphenyl)-2,5-dioxo-4,6,7,8-tetrahydro-3H-quinolin-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-(2,4-dimethoxyphenyl)-2,5-dioxo-4,6,7,8-tetrahydro-3H-quinolin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25039684 |
| Molecular Formula | C23H24N2O6S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 4-[4-(2,4-dimethoxyphenyl)-2,5-dioxo-4,6,7,8-tetrahydro-3H-quinolin-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(C2CC(=O)N(c3ccc(S(N)(=O)=O)cc3)C3=C2C(=O)CCC3)c(OC)c1 |
| InChI | InChI=1S/C23H24N2O6S/c1-30-15-8-11-17(21(12-15)31-2)18-13-22(27)25(19-4-3-5-20(26)23(18)19)14-6-9-16(10-7-14)32(24,28)29/h6-12,18H,3-5,13H2,1-2H3,(H2,24,28,29) |
| InChIKey | OJTDXFPWIBSBGB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |