C25H27NO4 — CID 23887260
4-(2,5-dimethoxyphenyl)-1-(2,3-dimethylphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione (PubChem CID 23887260) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-1-(2,3-dimethylphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione.
| Compound Name | 4-(2,5-dimethoxyphenyl)-1-(2,3-dimethylphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 23887260 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-1-(2,3-dimethylphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
| SMILES | COc1ccc(OC)c(C2CC(=O)N(c3cccc(C)c3C)C3=C2C(=O)CCC3)c1 |
| InChI | InChI=1S/C25H27NO4/c1-15-7-5-8-20(16(15)2)26-21-9-6-10-22(27)25(21)19(14-24(26)28)18-13-17(29-3)11-12-23(18)30-4/h5,7-8,11-13,19H,6,9-10,14H2,1-4H3 |
| InChIKey | DOPXPQPDZBTBGV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |