C26H29NO5 — CID 6496698
1-(2-ethylphenyl)-4-(2,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione (PubChem CID 6496698) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-4-(2,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione.
| Compound Name | 1-(2-ethylphenyl)-4-(2,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 6496698 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 1-(2-ethylphenyl)-4-(2,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
| SMILES | CCc1ccccc1N1C(=O)CC(c2cc(OC)c(OC)cc2OC)C2=C1CCCC2=O |
| InChI | InChI=1S/C26H29NO5/c1-5-16-9-6-7-10-19(16)27-20-11-8-12-21(28)26(20)18(14-25(27)29)17-13-23(31-3)24(32-4)15-22(17)30-2/h6-7,9-10,13,15,18H,5,8,11-12,14H2,1-4H3 |
| InChIKey | XYCMJLKGRIUPIC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |