C22H17ClN2O6S — CID 2402111
ethyl (2E)-2-[(5Z)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]acetate (PubChem CID 2402111) has the molecular formula C22H17ClN2O6S and a molecular weight of 472.91 g/mol. Its IUPAC name is ethyl (2E)-2-[(5Z)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(5Z)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 2402111 |
| Molecular Formula | C22H17ClN2O6S |
| Molecular Weight | 472.91 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | ethyl (2E)-2-[(5Z)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=c1/s/c(=C\c2ccc([N+](=O)[O-])cc2)c(=O)n1CC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H17ClN2O6S/c1-2-31-21(27)12-20-24(13-18(26)15-5-7-16(23)8-6-15)22(28)19(32-20)11-14-3-9-17(10-4-14)25(29)30/h3-12H,2,13H2,1H3/b19-11-,20-12+ |
| InChIKey | SKPZBYLVUYNSAL-UHWBUFEVSA-N |
| XLogP | 2.53 |
| TPSA | 108.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.91 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|