C14H12N2O4S2 — CID 9447830
ethyl (2Z)-2-[(5Z)-5-[(4-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-ylidene]acetate (PubChem CID 9447830) has the molecular formula C14H12N2O4S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is ethyl (2Z)-2-[(5Z)-5-[(4-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(5Z)-5-[(4-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-ylidene]acetate |
|---|---|
| PubChem CID | 9447830 |
| Molecular Formula | C14H12N2O4S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | ethyl (2Z)-2-[(5Z)-5-[(4-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-ylidene]acetate |
| SMILES | CCOC(=O)/C=c1\[nH]c(=S)s\c1=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H12N2O4S2/c1-2-20-13(17)8-11-12(22-14(21)15-11)7-9-3-5-10(6-4-9)16(18)19/h3-8H,2H2,1H3,(H,15,21)/b11-8-,12-7- |
| InChIKey | GIRWBDDRKZBYCW-HONFXZPPSA-N |
| XLogP | 1.89 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|