C20H21N3O5S — CID 3353152
ethyl 5-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-7-propyl-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3353152) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is ethyl 5-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-7-propyl-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-7-propyl-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3353152 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | ethyl 5-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-7-propyl-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCCC1N=c2sc(=Cc3ccc([N+](=O)[O-])cc3)c(=O)n2C(C)=C1C(=O)OCC |
| InChI | InChI=1S/C20H21N3O5S/c1-4-6-15-17(19(25)28-5-2)12(3)22-18(24)16(29-20(22)21-15)11-13-7-9-14(10-8-13)23(26)27/h7-11,15H,4-6H2,1-3H3 |
| InChIKey | CYGQERZSKGZRFB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|